C32H29N3O2S — CID 69152435
N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine-11-carbonyl)phenyl]-2-phenylbenzamide (PubChem CID 69152435) has the molecular formula C32H29N3O2S and a molecular weight of 519.67 g/mol. Its IUPAC name is N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine-11-carbonyl)phenyl]-2-phenylbenzamide.
| Compound Name | N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine-11-carbonyl)phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 69152435 |
| Molecular Formula | C32H29N3O2S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine-11-carbonyl)phenyl]-2-phenylbenzamide |
| SMILES | O=C(Nc1ccc(C(=O)C2CC=CC3=CNC=C4CSCCN4C32)cc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C32H29N3O2S/c36-31(29-12-6-9-24-19-33-20-26-21-38-18-17-35(26)30(24)29)23-13-15-25(16-14-23)34-32(37)28-11-5-4-10-27(28)22-7-2-1-3-8-22/h1-11,13-16,19-20,29-30,33H,12,17-18,21H2,(H,34,37) |
| InChIKey | SVJMVPQSIRDSSG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |