C34H34N4O2 — CID 20651266
N-[4-[9-(dimethylamino)-6,7,7a,8,9,10-hexahydropyrrolo[1,2-a][1,5]benzodiazepine-5-carbonyl]phenyl]-2-phenylbenzamide (PubChem CID 20651266) has the molecular formula C34H34N4O2 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[4-[9-(dimethylamino)-6,7,7a,8,9,10-hexahydropyrrolo[1,2-a][1,5]benzodiazepine-5-carbonyl]phenyl]-2-phenylbenzamide.
| Compound Name | N-[4-[9-(dimethylamino)-6,7,7a,8,9,10-hexahydropyrrolo[1,2-a][1,5]benzodiazepine-5-carbonyl]phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 20651266 |
| Molecular Formula | C34H34N4O2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | N-[4-[9-(dimethylamino)-6,7,7a,8,9,10-hexahydropyrrolo[1,2-a][1,5]benzodiazepine-5-carbonyl]phenyl]-2-phenylbenzamide |
| SMILES | CN(C)C1CC2CCN(C(=O)c3ccc(NC(=O)c4ccccc4-c4ccccc4)cc3)c3ccccc3N2C1 |
| InChI | InChI=1S/C34H34N4O2/c1-36(2)28-22-27-20-21-37(31-14-8-9-15-32(31)38(27)23-28)34(40)25-16-18-26(19-17-25)35-33(39)30-13-7-6-12-29(30)24-10-4-3-5-11-24/h3-19,27-28H,20-23H2,1-2H3,(H,35,39) |
| InChIKey | ZGBSISDCCFEGHY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |