C33H29N3O3S — CID 20651228
N-[4-[(6aR,8R)-8-hydroxy-11-sulfanylidene-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 20651228) has the molecular formula C33H29N3O3S and a molecular weight of 547.68 g/mol. Its IUPAC name is N-[4-[(6aR,8R)-8-hydroxy-11-sulfanylidene-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[4-[(6aR,8R)-8-hydroxy-11-sulfanylidene-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 20651228 |
| Molecular Formula | C33H29N3O3S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | N-[4-[(6aR,8R)-8-hydroxy-11-sulfanylidene-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)N3C[C@H]4C[C@@H](O)CN4C(=S)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C33H29N3O3S/c1-21-10-12-22(13-11-21)27-6-2-3-7-28(27)31(38)34-24-16-14-23(15-17-24)32(39)36-19-25-18-26(37)20-35(25)33(40)29-8-4-5-9-30(29)36/h2-17,25-26,37H,18-20H2,1H3,(H,34,38)/t25-,26-/m1/s1 |
| InChIKey | NIHMXZNYEDEDEQ-CLJLJLNGSA-N |
| XLogP | 5.69 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|