C32H28ClN3O2 — CID 70242260
N-[4-[(3aR)-2-chloro-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 70242260) has the molecular formula C32H28ClN3O2 and a molecular weight of 522.00 g/mol. Its IUPAC name is N-[4-[(3aR)-2-chloro-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[4-[(3aR)-2-chloro-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 70242260 |
| Molecular Formula | C32H28ClN3O2 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[4-[(3aR)-2-chloro-2,3,3a,4-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-5-carbonyl]phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | CC1=CC=C(C=C1)C2=CC=CC=C2C(=O)NC3=CC=C(C=C3)C(=O)N4C[C@H]5CC(CN5C6=CC=CC=C64)Cl |
| InChI | InChI=1S/C32H28ClN3O2/c1-21-10-12-22(13-11-21)27-6-2-3-7-28(27)31(37)34-25-16-14-23(15-17-25)32(38)36-20-26-18-24(33)19-35(26)29-8-4-5-9-30(29)36/h2-17,24,26H,18-20H2,1H3,(H,34,37)/t24?,26-/m1/s1 |
| InChIKey | IGYKTJCWHAIITP-JUERFOTFSA-N |
| XLogP | 6.50 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | 837 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|