C35H36N4O2 — CID 70245527
N-[4-[2-(dimethylamino)-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl]phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 70245527) has the molecular formula C35H36N4O2 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl]phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[4-[2-(dimethylamino)-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl]phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 70245527 |
| Molecular Formula | C35H36N4O2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | N-[4-[2-(dimethylamino)-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl]phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)C3C=C4C=CCN4C4=C(CCC(N(C)C)C4)N3)cc2)cc1 |
| InChI | InChI=1S/C35H36N4O2/c1-23-10-12-24(13-11-23)29-8-4-5-9-30(29)35(41)36-26-16-14-25(15-17-26)34(40)32-21-28-7-6-20-39(28)33-22-27(38(2)3)18-19-31(33)37-32/h4-17,21,27,32,37H,18-20,22H2,1-3H3,(H,36,41) |
| InChIKey | WWWVCQSKOHUICZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |