C32H30N4O2 — CID 70245544
N-[4-(2-amino-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl)phenyl]-2-phenylbenzamide (PubChem CID 70245544) has the molecular formula C32H30N4O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is N-[4-(2-amino-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl)phenyl]-2-phenylbenzamide.
| Compound Name | N-[4-(2-amino-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl)phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 70245544 |
| Molecular Formula | C32H30N4O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | N-[4-(2-amino-2,3,4,5,6,10-hexahydro-1H-pyrrolo[2,1-d][1,5]benzodiazepine-6-carbonyl)phenyl]-2-phenylbenzamide |
| SMILES | NC1CCC2=C(C1)N1CC=CC1=CC(C(=O)c1ccc(NC(=O)c3ccccc3-c3ccccc3)cc1)N2 |
| InChI | InChI=1S/C32H30N4O2/c33-23-14-17-28-30(19-23)36-18-6-9-25(36)20-29(35-28)31(37)22-12-15-24(16-13-22)34-32(38)27-11-5-4-10-26(27)21-7-2-1-3-8-21/h1-13,15-16,20,23,29,35H,14,17-19,33H2,(H,34,38) |
| InChIKey | YTEKZLACONCBAC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |