C26H23N5O2 — CID 69226615
N-[3-(8-amino-4-oxoquinazolin-3-yl)-4-methylphenyl]-3-(2-cyanopropan-2-yl)benzamide (PubChem CID 69226615) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[3-(8-amino-4-oxoquinazolin-3-yl)-4-methylphenyl]-3-(2-cyanopropan-2-yl)benzamide.
| Compound Name | N-[3-(8-amino-4-oxoquinazolin-3-yl)-4-methylphenyl]-3-(2-cyanopropan-2-yl)benzamide |
|---|---|
| PubChem CID | 69226615 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[3-(8-amino-4-oxoquinazolin-3-yl)-4-methylphenyl]-3-(2-cyanopropan-2-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(C)(C)C#N)c2)cc1-n1cnc2c(N)cccc2c1=O |
| InChI | InChI=1S/C26H23N5O2/c1-16-10-11-19(30-24(32)17-6-4-7-18(12-17)26(2,3)14-27)13-22(16)31-15-29-23-20(25(31)33)8-5-9-21(23)28/h4-13,15H,28H2,1-3H3,(H,30,32) |
| InChIKey | LHOXGANMKAMUAX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|