C34H38N6O2 — CID 69245696
3-(2-cyanopropan-2-yl)-N-[4-methyl-3-[4-oxo-6-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]phenyl]benzamide (PubChem CID 69245696) has the molecular formula C34H38N6O2 and a molecular weight of 562.72 g/mol. Its IUPAC name is 3-(2-cyanopropan-2-yl)-N-[4-methyl-3-[4-oxo-6-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]phenyl]benzamide.
| Compound Name | 3-(2-cyanopropan-2-yl)-N-[4-methyl-3-[4-oxo-6-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 69245696 |
| Molecular Formula | C34H38N6O2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 3-(2-cyanopropan-2-yl)-N-[4-methyl-3-[4-oxo-6-(3-piperidin-1-ylpropylamino)quinazolin-3-yl]phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(C)(C)C#N)c2)cc1-n1cnc2ccc(NCCCN3CCCCC3)cc2c1=O |
| InChI | InChI=1S/C34H38N6O2/c1-24-11-12-28(38-32(41)25-9-7-10-26(19-25)34(2,3)22-35)21-31(24)40-23-37-30-14-13-27(20-29(30)33(40)42)36-15-8-18-39-16-5-4-6-17-39/h7,9-14,19-21,23,36H,4-6,8,15-18H2,1-3H3,(H,38,41) |
| InChIKey | SXJRCZWWCAEKOQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|