C30H24N6O2 — CID 69355201
3-(2-cyanopropyl)-N-[4-methyl-3-(4-oxo-7-pyrimidin-5-ylquinazolin-3-yl)phenyl]benzamide (PubChem CID 69355201) has the molecular formula C30H24N6O2 and a molecular weight of 500.56 g/mol. Its IUPAC name is 3-(2-cyanopropyl)-N-[4-methyl-3-(4-oxo-7-pyrimidin-5-ylquinazolin-3-yl)phenyl]benzamide.
| Compound Name | 3-(2-cyanopropyl)-N-[4-methyl-3-(4-oxo-7-pyrimidin-5-ylquinazolin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 69355201 |
| Molecular Formula | C30H24N6O2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 3-(2-cyanopropyl)-N-[4-methyl-3-(4-oxo-7-pyrimidin-5-ylquinazolin-3-yl)phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(CC(C)C#N)c2)cc1-n1cnc2cc(-c3cncnc3)ccc2c1=O |
| InChI | InChI=1S/C30H24N6O2/c1-19(14-31)10-21-4-3-5-23(11-21)29(37)35-25-8-6-20(2)28(13-25)36-18-34-27-12-22(7-9-26(27)30(36)38)24-15-32-17-33-16-24/h3-9,11-13,15-19H,10H2,1-2H3,(H,35,37) |
| InChIKey | RLJIYHBQEYFLOA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |