C24H22N4O4S — CID 174524883
[3-[[4-methyl-3-[(3-methyl-4-oxoquinazolin-6-yl)amino]phenyl]carbamoyl]phenyl]methanesulfinic acid (PubChem CID 174524883) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is [3-[[4-methyl-3-[(3-methyl-4-oxoquinazolin-6-yl)amino]phenyl]carbamoyl]phenyl]methanesulfinic acid.
| Compound Name | [3-[[4-methyl-3-[(3-methyl-4-oxoquinazolin-6-yl)amino]phenyl]carbamoyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174524883 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [3-[[4-methyl-3-[(3-methyl-4-oxoquinazolin-6-yl)amino]phenyl]carbamoyl]phenyl]methanesulfinic acid |
| SMILES | Cc1ccc(NC(=O)c2cccc(CS(=O)O)c2)cc1Nc1ccc2ncn(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H22N4O4S/c1-15-6-7-19(27-23(29)17-5-3-4-16(10-17)13-33(31)32)12-22(15)26-18-8-9-21-20(11-18)24(30)28(2)14-25-21/h3-12,14,26H,13H2,1-2H3,(H,27,29)(H,31,32) |
| InChIKey | ZHYPVDMVBWAIOV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|