C24H29N3O3 — CID 69226683
(4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(imidazol-1-ylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 69226683) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is (4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(imidazol-1-ylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(imidazol-1-ylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 69226683 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(imidazol-1-ylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | Oc1ccc2c3c1OC1C(Cn4ccnc4)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C24H29N3O3/c28-18-4-3-16-11-19-24(29)6-5-17(13-26-10-8-25-14-26)22-23(24,20(16)21(18)30-22)7-9-27(19)12-15-1-2-15/h3-4,8,10,14-15,17,19,22,28-29H,1-2,5-7,9,11-13H2/t17?,19-,22?,23+,24-/m1/s1 |
| InChIKey | HZNWVOFHHCLLOH-NTQOHYBUSA-N |
| XLogP | 2.47 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |