C21H26ClOSi — CID 69229628
CID 69229628 (PubChem CID 69229628) has the molecular formula C21H26ClOSi and a molecular weight of 357.98 g/mol.
| Compound Name | CID 69229628 |
|---|---|
| PubChem CID | 69229628 |
| Molecular Formula | C21H26ClOSi |
| Molecular Weight | 357.98 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | — |
| SMILES | C=CCOc1c([Si](CCl)c2ccccc2)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C21H26ClOSi/c1-6-12-23-20-18(21(3,4)5)13-16(2)14-19(20)24(15-22)17-10-8-7-9-11-17/h6-11,13-14H,1,12,15H2,2-5H3 |
| InChIKey | BXBDUOMQCIMSTK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|