C13H22N+ — CID 69232450
1-butyl-2,4-diethylpyridin-1-ium (PubChem CID 69232450) has the molecular formula C13H22N+ and a molecular weight of 192.33 g/mol. Its IUPAC name is 1-butyl-2,4-diethylpyridin-1-ium.
| Compound Name | 1-butyl-2,4-diethylpyridin-1-ium |
|---|---|
| PubChem CID | 69232450 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | 1-butyl-2,4-diethylpyridin-1-ium |
| SMILES | CCCC[n+]1ccc(CC)cc1CC |
| InChI | InChI=1S/C13H22N/c1-4-7-9-14-10-8-12(5-2)11-13(14)6-3/h8,10-11H,4-7,9H2,1-3H3/q+1 |
| InChIKey | USBUASGMPNYWBK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|