C13H10N2 — CID 69234589
1-ethenylpyrido[3,2-b]indole (PubChem CID 69234589) has the molecular formula C13H10N2 and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-ethenylpyrido[3,2-b]indole.
| Compound Name | 1-ethenylpyrido[3,2-b]indole |
|---|---|
| PubChem CID | 69234589 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-ethenylpyrido[3,2-b]indole |
| SMILES | C=Cn1cccc2nc3ccccc3c1-2 |
| InChI | InChI=1S/C13H10N2/c1-2-15-9-5-8-12-13(15)10-6-3-4-7-11(10)14-12/h2-9H,1H2 |
| InChIKey | PLQSGRQBTLEQNB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |