C51H69N3O4 — CID 69235104
tert-butyl N,N-bis[(2S,3R)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]-1-(3-prop-2-enylphenyl)butan-2-yl]carbamate (PubChem CID 69235104) has the molecular formula C51H69N3O4 and a molecular weight of 788.13 g/mol. Its IUPAC name is tert-butyl N,N-bis[(2S,3R)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]-1-(3-prop-2-enylphenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N,N-bis[(2S,3R)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]-1-(3-prop-2-enylphenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 69235104 |
| Molecular Formula | C51H69N3O4 |
| Molecular Weight | 788.13 g/mol |
| Exact Mass | 787.53 |
| IUPAC Name | tert-butyl N,N-bis[(2S,3R)-3-hydroxy-4-[(3-propan-2-ylphenyl)methylamino]-1-(3-prop-2-enylphenyl)butan-2-yl]carbamate |
| SMILES | C=CCc1cccc(C[C@@H]([C@H](O)CNCc2cccc(C(C)C)c2)N(C(=O)OC(C)(C)C)[C@@H](Cc2cccc(CC=C)c2)[C@H](O)CNCc2cccc(C(C)C)c2)c1 |
| InChI | InChI=1S/C51H69N3O4/c1-10-16-38-18-12-20-40(26-38)30-46(48(55)34-52-32-42-22-14-24-44(28-42)36(3)4)54(50(57)58-51(7,8)9)47(31-41-21-13-19-39(27-41)17-11-2)49(56)35-53-33-43-23-15-25-45(29-43)37(5)6/h10-15,18-29,36-37,46-49,52-53,55-56H,1-2,16-17,30-35H2,3-9H3/t46-,47-,48+,49+/m0/s1 |
| InChIKey | PSODNXOWXAFPPG-HUMWUIFSSA-N |
| XLogP | 9.45 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.13 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|