C25H26ClNO3 — CID 69240400
5-(2-bicyclo[2.2.1]heptanyl)-3-chloro-1-(4-propan-2-yloxyphenyl)indole-2-carboxylic acid (PubChem CID 69240400) has the molecular formula C25H26ClNO3 and a molecular weight of 423.94 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]heptanyl)-3-chloro-1-(4-propan-2-yloxyphenyl)indole-2-carboxylic acid.
| Compound Name | 5-(2-bicyclo[2.2.1]heptanyl)-3-chloro-1-(4-propan-2-yloxyphenyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 69240400 |
| Molecular Formula | C25H26ClNO3 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]heptanyl)-3-chloro-1-(4-propan-2-yloxyphenyl)indole-2-carboxylic acid |
| SMILES | CC(C)Oc1ccc(-n2c(C(=O)O)c(Cl)c3cc(C4CC5CCC4C5)ccc32)cc1 |
| InChI | InChI=1S/C25H26ClNO3/c1-14(2)30-19-8-6-18(7-9-19)27-22-10-5-17(20-12-15-3-4-16(20)11-15)13-21(22)23(26)24(27)25(28)29/h5-10,13-16,20H,3-4,11-12H2,1-2H3,(H,28,29) |
| InChIKey | HQZWUSLAPDVWNG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |