C26H23Cl2NO3S — CID 69242063
ethyl 3-chloro-5-(4-chlorophenyl)sulfanyl-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate (PubChem CID 69242063) has the molecular formula C26H23Cl2NO3S and a molecular weight of 500.45 g/mol. Its IUPAC name is ethyl 3-chloro-5-(4-chlorophenyl)sulfanyl-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate.
| Compound Name | ethyl 3-chloro-5-(4-chlorophenyl)sulfanyl-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 69242063 |
| Molecular Formula | C26H23Cl2NO3S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | ethyl 3-chloro-5-(4-chlorophenyl)sulfanyl-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)c2cc(Sc3ccc(Cl)cc3)ccc2n1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C26H23Cl2NO3S/c1-4-31-26(30)25-24(28)22-15-21(33-20-11-5-17(27)6-12-20)13-14-23(22)29(25)18-7-9-19(10-8-18)32-16(2)3/h5-16H,4H2,1-3H3 |
| InChIKey | AIYFGDFKQULXBM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |