About ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate
ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate (PubChem CID 69239686) has the molecular formula C26H32N2O5
and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate |
| PubChem CID | 69239686 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NCC(=O)C(C)(C)C)c2cc(O)ccc2n1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C26H32N2O5/c1-7-32-25(31)24-23(27-15-22(30)26(4,5)6)20-14-18(29)10-13-21(20)28(24)17-8-11-19(12-9-17)33-16(2)3/h8-14,16,27,29H,7,15H2,1-6H3 |
| InChIKey | AQTOGBYJLAYKNZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate?
The IUPAC name of ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate (CID 69239686) is ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate.
What is the SMILES notation for ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate?
The canonical SMILES for ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate is CCOC(=O)c1c(NCC(=O)C(C)(C)C)c2cc(O)ccc2n1-c1ccc(OC(C)C)cc1.
What is the InChIKey of ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate?
The InChIKey is AQTOGBYJLAYKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O5/c1-7-32-25(31)24-23(27-15-22(30)26(4,5)6)20-14-18(29)10-13-21(20)28(24)17-8-11-19(12-9-17)33-16(2)3/h8-14,16,27,29H,7,15H2,1-6H3.
What are the key properties of ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate?
ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate has a molecular weight of 452.55 g/mol, XLogP of 5.33, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(3,3-dimethyl-2-oxobutyl)amino]-5-hydroxy-1-(4-propan-2-yloxyphenyl)indole-2-carboxylate is sourced from PubChem (CID 69239686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).