C27H32BNO6 — CID 86628826
ethyl 3-formyl-1-(4-propan-2-yloxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-2-carboxylate (PubChem CID 86628826) has the molecular formula C27H32BNO6 and a molecular weight of 477.37 g/mol. Its IUPAC name is ethyl 3-formyl-1-(4-propan-2-yloxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-2-carboxylate.
| Compound Name | ethyl 3-formyl-1-(4-propan-2-yloxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-2-carboxylate |
|---|---|
| PubChem CID | 86628826 |
| Molecular Formula | C27H32BNO6 |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | ethyl 3-formyl-1-(4-propan-2-yloxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C=O)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C27H32BNO6/c1-8-32-25(31)24-22(16-30)21-15-18(28-34-26(4,5)27(6,7)35-28)9-14-23(21)29(24)19-10-12-20(13-11-19)33-17(2)3/h9-17H,8H2,1-7H3 |
| InChIKey | XPGOCLCSQRZCPF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|