About ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate
ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate (PubChem CID 68695991) has the molecular formula C31H34N2O5
and a molecular weight of 514.62 g/mol. Its IUPAC name is ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate |
| PubChem CID | 68695991 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(NC(C)=O)c(-c3ccc(OC(C)C)cc3)ccc2n1-c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C31H34N2O5/c1-7-36-31(35)29-18-27-28(33(29)23-10-14-25(15-11-23)38-20(4)5)17-16-26(30(27)32-21(6)34)22-8-12-24(13-9-22)37-19(2)3/h8-20H,7H2,1-6H3,(H,32,34) |
| InChIKey | XUUSQCBJBCNXMR-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate?
The IUPAC name of ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate (CID 68695991) is ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate.
What is the SMILES notation for ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate?
The canonical SMILES for ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate is CCOC(=O)c1cc2c(NC(C)=O)c(-c3ccc(OC(C)C)cc3)ccc2n1-c1ccc(OC(C)C)cc1.
What is the InChIKey of ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate?
The InChIKey is XUUSQCBJBCNXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H34N2O5/c1-7-36-31(35)29-18-27-28(33(29)23-10-14-25(15-11-23)38-20(4)5)17-16-26(30(27)32-21(6)34)22-8-12-24(13-9-22)37-19(2)3/h8-20H,7H2,1-6H3,(H,32,34).
What are the key properties of ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate?
ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate has a molecular weight of 514.62 g/mol, XLogP of 7.01, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-acetamido-1,5-bis(4-propan-2-yloxyphenyl)indole-2-carboxylate is sourced from PubChem (CID 68695991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).