C23H23ClFN7 — CID 69242148
N-(2-chloro-4-fluorophenyl)-1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 69242148) has the molecular formula C23H23ClFN7 and a molecular weight of 451.94 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(2-chloro-4-fluorophenyl)-1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 69242148 |
| Molecular Formula | C23H23ClFN7 |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-1-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CN(C)C1CCN(c2ccc(-n3ncc4c(Nc5ccc(F)cc5Cl)ncnc43)cc2)C1 |
| InChI | InChI=1S/C23H23ClFN7/c1-30(2)18-9-10-31(13-18)16-4-6-17(7-5-16)32-23-19(12-28-32)22(26-14-27-23)29-21-8-3-15(25)11-20(21)24/h3-8,11-12,14,18H,9-10,13H2,1-2H3,(H,26,27,29) |
| InChIKey | RZBHKDAWWCLQPS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|