C21H20N3O+ — CID 6924222
2-[(S)-(2-methyl-1H-indol-3-yl)-(pyridin-1-ium-2-ylamino)methyl]phenol (PubChem CID 6924222) has the molecular formula C21H20N3O+ and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[(S)-(2-methyl-1H-indol-3-yl)-(pyridin-1-ium-2-ylamino)methyl]phenol.
| Compound Name | 2-[(S)-(2-methyl-1H-indol-3-yl)-(pyridin-1-ium-2-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 6924222 |
| Molecular Formula | C21H20N3O+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[(S)-(2-methyl-1H-indol-3-yl)-(pyridin-1-ium-2-ylamino)methyl]phenol |
| SMILES | Cc1[nH]c2ccccc2c1[C@H](Nc1cccc[nH+]1)c1ccccc1O |
| InChI | InChI=1S/C21H19N3O/c1-14-20(15-8-2-4-10-17(15)23-14)21(16-9-3-5-11-18(16)25)24-19-12-6-7-13-22-19/h2-13,21,23,25H,1H3,(H,22,24)/p+1/t21-/m1/s1 |
| InChIKey | FKAHSBXKXQRRCW-OAQYLSRUSA-O |
| XLogP | 4.20 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|