C21H18Cl2N3+ — CID 7024570
N-[(S)-(3,4-dichlorophenyl)-(2-methyl-1H-indol-3-yl)methyl]pyridin-1-ium-2-amine (PubChem CID 7024570) has the molecular formula C21H18Cl2N3+ and a molecular weight of 383.30 g/mol. Its IUPAC name is N-[(S)-(3,4-dichlorophenyl)-(2-methyl-1H-indol-3-yl)methyl]pyridin-1-ium-2-amine.
| Compound Name | N-[(S)-(3,4-dichlorophenyl)-(2-methyl-1H-indol-3-yl)methyl]pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 7024570 |
| Molecular Formula | C21H18Cl2N3+ |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(S)-(3,4-dichlorophenyl)-(2-methyl-1H-indol-3-yl)methyl]pyridin-1-ium-2-amine |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](Nc1cccc[nH+]1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N3/c1-13-20(15-6-2-3-7-18(15)25-13)21(26-19-8-4-5-11-24-19)14-9-10-16(22)17(23)12-14/h2-12,21,25H,1H3,(H,24,26)/p+1/t21-/m0/s1 |
| InChIKey | IKBXYEIEFAOFAG-NRFANRHFSA-O |
| XLogP | 5.80 |
| TPSA | 41.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|