C24H23FN2O2 — CID 23821424
N-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-4-fluoroaniline (PubChem CID 23821424) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-4-fluoroaniline.
| Compound Name | N-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 23821424 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]-4-fluoroaniline |
| SMILES | COc1ccc(C(Nc2ccc(F)cc2)c2c(C)[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C24H23FN2O2/c1-15-23(19-6-4-5-7-20(19)26-15)24(27-18-11-9-17(25)10-12-18)16-8-13-21(28-2)22(14-16)29-3/h4-14,24,26-27H,1-3H3 |
| InChIKey | BLQLIEVTSMQETE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|