C26H24N2O4 — CID 23819263
ethyl 4-[[1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate (PubChem CID 23819263) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 4-[[1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 23819263 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl 4-[[1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(c2ccc3c(c2)OCO3)c2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-3-30-26(29)17-8-11-19(12-9-17)28-25(18-10-13-22-23(14-18)32-15-31-22)24-16(2)27-21-7-5-4-6-20(21)24/h4-14,25,27-28H,3,15H2,1-2H3 |
| InChIKey | RKYLEFNMTFRXME-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|