C20H17N3O2S — CID 1185898
N-[(R)-1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 1185898) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[(R)-1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(R)-1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1185898 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[(R)-1,3-benzodioxol-5-yl-(2-methyl-1H-indol-3-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1[nH]c2ccccc2c1[C@H](Nc1nccs1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H17N3O2S/c1-12-18(14-4-2-3-5-15(14)22-12)19(23-20-21-8-9-26-20)13-6-7-16-17(10-13)25-11-24-16/h2-10,19,22H,11H2,1H3,(H,21,23)/t19-/m1/s1 |
| InChIKey | DJNUCQPGRNWGBO-LJQANCHMSA-N |
| XLogP | 4.86 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|