C27H28N2O4 — CID 3429869
ethyl 4-[[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate (PubChem CID 3429869) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is ethyl 4-[[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate.
| Compound Name | ethyl 4-[[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 3429869 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | ethyl 4-[[(3,4-dimethoxyphenyl)-(2-methyl-1H-indol-3-yl)methyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(c2ccc(OC)c(OC)c2)c2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H28N2O4/c1-5-33-27(30)18-10-13-20(14-11-18)29-26(19-12-15-23(31-3)24(16-19)32-4)25-17(2)28-22-9-7-6-8-21(22)25/h6-16,26,28-29H,5H2,1-4H3 |
| InChIKey | FIRWJRKWKBDSMQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|