About 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one
9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one (PubChem CID 69242237) has the molecular formula C16H11N3O
and a molecular weight of 261.28 g/mol. Its IUPAC name is 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one.
Molecular Properties
| Compound Name | 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one |
| PubChem CID | 69242237 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one |
| SMILES | O=C1NCc2nc3ccccc3c(-c3cccnc3)c21 |
| InChI | InChI=1S/C16H11N3O/c20-16-15-13(9-18-16)19-12-6-2-1-5-11(12)14(15)10-4-3-7-17-8-10/h1-8H,9H2,(H,18,20) |
| InChIKey | ZMRCWQXGSALPNU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one?
The IUPAC name of 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one (CID 69242237) is 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one.
What is the SMILES notation for 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one?
The canonical SMILES for 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one is O=C1NCc2nc3ccccc3c(-c3cccnc3)c21.
What is the InChIKey of 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one?
The InChIKey is ZMRCWQXGSALPNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O/c20-16-15-13(9-18-16)19-12-6-2-1-5-11(12)14(15)10-4-3-7-17-8-10/h1-8H,9H2,(H,18,20).
What are the key properties of 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one?
9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one has a molecular weight of 261.28 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pyridin-3-yl-2,3-dihydropyrrolo[3,4-b]quinolin-1-one is sourced from PubChem (CID 69242237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).