C26H37NO4S — CID 69243582
2-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methylsulfanyl]heptanoic acid (PubChem CID 69243582) has the molecular formula C26H37NO4S and a molecular weight of 459.65 g/mol. Its IUPAC name is 2-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methylsulfanyl]heptanoic acid.
| Compound Name | 2-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methylsulfanyl]heptanoic acid |
|---|---|
| PubChem CID | 69243582 |
| Molecular Formula | C26H37NO4S |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-[[(1S,3R)-3-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]methylsulfanyl]heptanoic acid |
| SMILES | CCCCCC(SC[C@H]1CCC[C@@H](OCc2nc(-c3ccc(C)cc3)oc2C)C1)C(=O)O |
| InChI | InChI=1S/C26H37NO4S/c1-4-5-6-10-24(26(28)29)32-17-20-8-7-9-22(15-20)30-16-23-19(3)31-25(27-23)21-13-11-18(2)12-14-21/h11-14,20,22,24H,4-10,15-17H2,1-3H3,(H,28,29)/t20-,22+,24?/m0/s1 |
| InChIKey | ITFLYMSQFDOPIU-GWKQTIPISA-N |
| XLogP | 6.80 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|