C16H23N3O — CID 69248536
3-[(3-butoxyphenyl)methyl]-2H-pyridine-2,3-diamine (PubChem CID 69248536) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[(3-butoxyphenyl)methyl]-2H-pyridine-2,3-diamine.
| Compound Name | 3-[(3-butoxyphenyl)methyl]-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 69248536 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-[(3-butoxyphenyl)methyl]-2H-pyridine-2,3-diamine |
| SMILES | CCCCOc1cccc(CC2(N)C=CC=NC2N)c1 |
| InChI | InChI=1S/C16H23N3O/c1-2-3-10-20-14-7-4-6-13(11-14)12-16(18)8-5-9-19-15(16)17/h4-9,11,15H,2-3,10,12,17-18H2,1H3 |
| InChIKey | UHFLSTXUNKLFQO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|