C16H21N2S+ — CID 6924983
(9S)-9-methyl-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinolin-6-ium-11-amine (PubChem CID 6924983) has the molecular formula C16H21N2S+ and a molecular weight of 273.42 g/mol. Its IUPAC name is (9S)-9-methyl-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinolin-6-ium-11-amine.
| Compound Name | (9S)-9-methyl-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinolin-6-ium-11-amine |
|---|---|
| PubChem CID | 6924983 |
| Molecular Formula | C16H21N2S+ |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (9S)-9-methyl-1,2,3,4,7,8,9,10-octahydro-[1]benzothiolo[2,3-b]quinolin-6-ium-11-amine |
| SMILES | C[C@H]1CCc2[nH+]c3sc4c(c3c(N)c2C1)CCCC4 |
| InChI | InChI=1S/C16H20N2S/c1-9-6-7-12-11(8-9)15(17)14-10-4-2-3-5-13(10)19-16(14)18-12/h9H,2-8H2,1H3,(H2,17,18)/p+1/t9-/m0/s1 |
| InChIKey | ASNZHKJGGYRNAY-VIFPVBQESA-O |
| XLogP | 3.30 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |