C19H32N4O2 — CID 69250731
cyclohexane;[2-(4-propan-2-ylpiperazin-1-yl)-4-pyridinyl]carbamic acid (PubChem CID 69250731) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is cyclohexane;[2-(4-propan-2-ylpiperazin-1-yl)-4-pyridinyl]carbamic acid.
| Compound Name | cyclohexane;[2-(4-propan-2-ylpiperazin-1-yl)-4-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 69250731 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | cyclohexane;[2-(4-propan-2-ylpiperazin-1-yl)-4-pyridinyl]carbamic acid |
| SMILES | C1CCCCC1.CC(C)N1CCN(c2cc(NC(=O)O)ccn2)CC1 |
| InChI | InChI=1S/C13H20N4O2.C6H12/c1-10(2)16-5-7-17(8-6-16)12-9-11(3-4-14-12)15-13(18)19;1-2-4-6-5-3-1/h3-4,9-10H,5-8H2,1-2H3,(H,14,15)(H,18,19);1-6H2 |
| InChIKey | HHHZQNXXHNYFQU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |