C24H26N4O5S — CID 69252977
8-(1-acetylpiperidin-4-yl)sulfonyl-4-(3-methoxyanilino)quinoline-3-carboxamide (PubChem CID 69252977) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 8-(1-acetylpiperidin-4-yl)sulfonyl-4-(3-methoxyanilino)quinoline-3-carboxamide.
| Compound Name | 8-(1-acetylpiperidin-4-yl)sulfonyl-4-(3-methoxyanilino)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 69252977 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 8-(1-acetylpiperidin-4-yl)sulfonyl-4-(3-methoxyanilino)quinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(S(=O)(=O)C4CCN(C(C)=O)CC4)cccc23)c1 |
| InChI | InChI=1S/C24H26N4O5S/c1-15(29)28-11-9-18(10-12-28)34(31,32)21-8-4-7-19-22(20(24(25)30)14-26-23(19)21)27-16-5-3-6-17(13-16)33-2/h3-8,13-14,18H,9-12H2,1-2H3,(H2,25,30)(H,26,27) |
| InChIKey | SHOFBMOJCYSPNR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |