C35H39N5O6S — CID 86659096
4-(3-methoxyanilino)-8-methyl-6-[3-[4-(6-oxohexyl)piperazine-1-carbonyl]phenyl]sulfonylquinoline-3-carboxamide (PubChem CID 86659096) has the molecular formula C35H39N5O6S and a molecular weight of 657.79 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-8-methyl-6-[3-[4-(6-oxohexyl)piperazine-1-carbonyl]phenyl]sulfonylquinoline-3-carboxamide.
| Compound Name | 4-(3-methoxyanilino)-8-methyl-6-[3-[4-(6-oxohexyl)piperazine-1-carbonyl]phenyl]sulfonylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 86659096 |
| Molecular Formula | C35H39N5O6S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | 4-(3-methoxyanilino)-8-methyl-6-[3-[4-(6-oxohexyl)piperazine-1-carbonyl]phenyl]sulfonylquinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4cccc(C(=O)N5CCN(CCCCCC=O)CC5)c4)cc23)c1 |
| InChI | InChI=1S/C35H39N5O6S/c1-24-19-29(22-30-32(24)37-23-31(34(36)42)33(30)38-26-10-8-11-27(21-26)46-2)47(44,45)28-12-7-9-25(20-28)35(43)40-16-14-39(15-17-40)13-5-3-4-6-18-41/h7-12,18-23H,3-6,13-17H2,1-2H3,(H2,36,42)(H,37,38) |
| InChIKey | QYWGWAYVNXNSKL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|