C41H55N5O6SSi — CID 66988288
6-[3-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]piperazine-1-carbonyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide (PubChem CID 66988288) has the molecular formula C41H55N5O6SSi and a molecular weight of 774.07 g/mol. Its IUPAC name is 6-[3-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]piperazine-1-carbonyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide.
| Compound Name | 6-[3-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]piperazine-1-carbonyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66988288 |
| Molecular Formula | C41H55N5O6SSi |
| Molecular Weight | 774.07 g/mol |
| Exact Mass | 773.36 |
| IUPAC Name | 6-[3-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]piperazine-1-carbonyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4cccc(C(=O)N5CCN(CCCCCCO[Si](C)(C)C(C)(C)C)CC5)c4)cc23)c1 |
| InChI | InChI=1S/C41H55N5O6SSi/c1-29-24-34(27-35-37(29)43-28-36(39(42)47)38(35)44-31-15-13-16-32(26-31)51-5)53(49,50)33-17-12-14-30(25-33)40(48)46-21-19-45(20-22-46)18-10-8-9-11-23-52-54(6,7)41(2,3)4/h12-17,24-28H,8-11,18-23H2,1-7H3,(H2,42,47)(H,43,44) |
| InChIKey | GQGMDQXDRAYTRE-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.07 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|