C35H35N3O5S — CID 66988945
6-[4-[4-(5-hydroxypentyl)phenyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide (PubChem CID 66988945) has the molecular formula C35H35N3O5S and a molecular weight of 609.75 g/mol. Its IUPAC name is 6-[4-[4-(5-hydroxypentyl)phenyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide.
| Compound Name | 6-[4-[4-(5-hydroxypentyl)phenyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66988945 |
| Molecular Formula | C35H35N3O5S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | 6-[4-[4-(5-hydroxypentyl)phenyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4ccc(-c5ccc(CCCCCO)cc5)cc4)cc23)c1 |
| InChI | InChI=1S/C35H35N3O5S/c1-23-19-30(21-31-33(23)37-22-32(35(36)40)34(31)38-27-8-6-9-28(20-27)43-2)44(41,42)29-16-14-26(15-17-29)25-12-10-24(11-13-25)7-4-3-5-18-39/h6,8-17,19-22,39H,3-5,7,18H2,1-2H3,(H2,36,40)(H,37,38) |
| InChIKey | AODKPPOFJNJHST-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|