C36H35N3O3 — CID 58505080
4-(3-methoxyanilino)-8-methyl-6-[[4-[4-(5-oxopentyl)phenyl]phenyl]methyl]quinoline-3-carboxamide (PubChem CID 58505080) has the molecular formula C36H35N3O3 and a molecular weight of 557.69 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-8-methyl-6-[[4-[4-(5-oxopentyl)phenyl]phenyl]methyl]quinoline-3-carboxamide.
| Compound Name | 4-(3-methoxyanilino)-8-methyl-6-[[4-[4-(5-oxopentyl)phenyl]phenyl]methyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 58505080 |
| Molecular Formula | C36H35N3O3 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 4-(3-methoxyanilino)-8-methyl-6-[[4-[4-(5-oxopentyl)phenyl]phenyl]methyl]quinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(Cc4ccc(-c5ccc(CCCCC=O)cc5)cc4)cc23)c1 |
| InChI | InChI=1S/C36H35N3O3/c1-24-19-27(20-26-12-16-29(17-13-26)28-14-10-25(11-15-28)7-4-3-5-18-40)21-32-34(24)38-23-33(36(37)41)35(32)39-30-8-6-9-31(22-30)42-2/h6,8-19,21-23H,3-5,7,20H2,1-2H3,(H2,37,41)(H,38,39) |
| InChIKey | QBFGQOTZZFWDMD-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|