C42H47BrN4O6S — CID 66988130
6-[3-[[4-[4-(6-bromohexoxy)butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide (PubChem CID 66988130) has the molecular formula C42H47BrN4O6S and a molecular weight of 815.83 g/mol. Its IUPAC name is 6-[3-[[4-[4-(6-bromohexoxy)butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide.
| Compound Name | 6-[3-[[4-[4-(6-bromohexoxy)butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66988130 |
| Molecular Formula | C42H47BrN4O6S |
| Molecular Weight | 815.83 g/mol |
| Exact Mass | 814.24 |
| IUPAC Name | 6-[3-[[4-[4-(6-bromohexoxy)butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4cccc(C(=O)N(C)c5ccc(CCCCOCCCCCCBr)cc5)c4)cc23)c1 |
| InChI | InChI=1S/C42H47BrN4O6S/c1-29-24-36(27-37-39(29)45-28-38(41(44)48)40(37)46-32-14-11-15-34(26-32)52-3)54(50,51)35-16-10-13-31(25-35)42(49)47(2)33-19-17-30(18-20-33)12-6-9-23-53-22-8-5-4-7-21-43/h10-11,13-20,24-28H,4-9,12,21-23H2,1-3H3,(H2,44,48)(H,45,46) |
| InChIKey | CKFSVIBKDMFPOR-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.83 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|