C48H62N4O7SSi — CID 71290282
6-[3-[[4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide (PubChem CID 71290282) has the molecular formula C48H62N4O7SSi and a molecular weight of 867.20 g/mol. Its IUPAC name is 6-[3-[[4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide.
| Compound Name | 6-[3-[[4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 71290282 |
| Molecular Formula | C48H62N4O7SSi |
| Molecular Weight | 867.20 g/mol |
| Exact Mass | 866.41 |
| IUPAC Name | 6-[3-[[4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]butyl]phenyl]-methylcarbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4cccc(C(=O)N(C)c5ccc(CCCCOCCCCCCO[Si](C)(C)C(C)(C)C)cc5)c4)cc23)c1 |
| InChI | InChI=1S/C48H62N4O7SSi/c1-34-29-41(32-42-44(34)50-33-43(46(49)53)45(42)51-37-19-16-20-39(31-37)57-6)60(55,56)40-21-15-18-36(30-40)47(54)52(5)38-24-22-35(23-25-38)17-11-14-27-58-26-12-9-10-13-28-59-61(7,8)48(2,3)4/h15-16,18-25,29-33H,9-14,17,26-28H2,1-8H3,(H2,49,53)(H,50,51) |
| InChIKey | RQTKTYYCDMPNFA-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 150.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.20 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|