C36H32N4O6S — CID 66988354
6-[3-[[3-(5-hydroxypent-1-ynyl)phenyl]carbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide (PubChem CID 66988354) has the molecular formula C36H32N4O6S and a molecular weight of 648.74 g/mol. Its IUPAC name is 6-[3-[[3-(5-hydroxypent-1-ynyl)phenyl]carbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide.
| Compound Name | 6-[3-[[3-(5-hydroxypent-1-ynyl)phenyl]carbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66988354 |
| Molecular Formula | C36H32N4O6S |
| Molecular Weight | 648.74 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | 6-[3-[[3-(5-hydroxypent-1-ynyl)phenyl]carbamoyl]phenyl]sulfonyl-4-(3-methoxyanilino)-8-methylquinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4cccc(C(=O)Nc5cccc(C#CCCCO)c5)c4)cc23)c1 |
| InChI | InChI=1S/C36H32N4O6S/c1-23-17-30(21-31-33(23)38-22-32(35(37)42)34(31)39-27-13-8-14-28(20-27)46-2)47(44,45)29-15-7-11-25(19-29)36(43)40-26-12-6-10-24(18-26)9-4-3-5-16-41/h6-8,10-15,17-22,41H,3,5,16H2,1-2H3,(H2,37,42)(H,38,39)(H,40,43) |
| InChIKey | HFFPFPNQDKMFLY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|