C21H32O4 — CID 69254540
(6S,8R,9S,10R,13S,14S)-6-(methoxymethyl)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17,17-triol (PubChem CID 69254540) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S)-6-(methoxymethyl)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17,17-triol.
| Compound Name | (6S,8R,9S,10R,13S,14S)-6-(methoxymethyl)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17,17-triol |
|---|---|
| PubChem CID | 69254540 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S)-6-(methoxymethyl)-10,13-dimethyl-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17,17-triol |
| SMILES | COC[C@H]1C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CCC3(O)O)[C@@]2(C)C=CC(O)C=C12 |
| InChI | InChI=1S/C21H32O4/c1-19-7-4-14(22)11-18(19)13(12-25-3)10-15-16(19)5-8-20(2)17(15)6-9-21(20,23)24/h4,7,11,13-17,22-24H,5-6,8-10,12H2,1-3H3/t13-,14?,15-,16+,17+,19-,20+/m1/s1 |
| InChIKey | KANIBAYHFXCOSI-KPJWQUKNSA-N |
| XLogP | 2.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|