C37H48IN7O7S2 — CID 69255756
N-[1-[(3-amino-5-ethoxy-4-iodophenyl)methyl]piperidin-4-yl]-5-ethylsulfonyl-1,3-benzoxazol-2-amine;5-ethylsulfonyl-N-piperidin-4-yl-1,3-benzoxazol-2-amine (PubChem CID 69255756) has the molecular formula C37H48IN7O7S2 and a molecular weight of 893.87 g/mol. Its IUPAC name is N-[1-[(3-amino-5-ethoxy-4-iodophenyl)methyl]piperidin-4-yl]-5-ethylsulfonyl-1,3-benzoxazol-2-amine;5-ethylsulfonyl-N-piperidin-4-yl-1,3-benzoxazol-2-amine.
| Compound Name | N-[1-[(3-amino-5-ethoxy-4-iodophenyl)methyl]piperidin-4-yl]-5-ethylsulfonyl-1,3-benzoxazol-2-amine;5-ethylsulfonyl-N-piperidin-4-yl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 69255756 |
| Molecular Formula | C37H48IN7O7S2 |
| Molecular Weight | 893.87 g/mol |
| Exact Mass | 893.21 |
| IUPAC Name | N-[1-[(3-amino-5-ethoxy-4-iodophenyl)methyl]piperidin-4-yl]-5-ethylsulfonyl-1,3-benzoxazol-2-amine;5-ethylsulfonyl-N-piperidin-4-yl-1,3-benzoxazol-2-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3nc4cc(S(=O)(=O)CC)ccc4o3)CC2)cc(N)c1I.CCS(=O)(=O)c1ccc2oc(NC3CCNCC3)nc2c1 |
| InChI | InChI=1S/C23H29IN4O4S.C14H19N3O3S/c1-3-31-21-12-15(11-18(25)22(21)24)14-28-9-7-16(8-10-28)26-23-27-19-13-17(33(29,30)4-2)5-6-20(19)32-23;1-2-21(18,19)11-3-4-13-12(9-11)17-14(20-13)16-10-5-7-15-8-6-10/h5-6,11-13,16H,3-4,7-10,14,25H2,1-2H3,(H,26,27);3-4,9-10,15H,2,5-8H2,1H3,(H,16,17) |
| InChIKey | QBCYOMUFCRAWAJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 194.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.87 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|