C27H27N5O4 — CID 69258107
2-methoxy-N-[3-[4-[3-methyl-4-(6-methyl-1-oxidopyridin-1-ium-3-yl)oxyanilino]quinazolin-6-yl]prop-2-enyl]acetamide (PubChem CID 69258107) has the molecular formula C27H27N5O4 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-methoxy-N-[3-[4-[3-methyl-4-(6-methyl-1-oxidopyridin-1-ium-3-yl)oxyanilino]quinazolin-6-yl]prop-2-enyl]acetamide.
| Compound Name | 2-methoxy-N-[3-[4-[3-methyl-4-(6-methyl-1-oxidopyridin-1-ium-3-yl)oxyanilino]quinazolin-6-yl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 69258107 |
| Molecular Formula | C27H27N5O4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-methoxy-N-[3-[4-[3-methyl-4-(6-methyl-1-oxidopyridin-1-ium-3-yl)oxyanilino]quinazolin-6-yl]prop-2-enyl]acetamide |
| SMILES | COCC(=O)NCC=Cc1ccc2ncnc(Nc3ccc(Oc4ccc(C)[n+]([O-])c4)c(C)c3)c2c1 |
| InChI | InChI=1S/C27H27N5O4/c1-18-13-21(8-11-25(18)36-22-9-6-19(2)32(34)15-22)31-27-23-14-20(7-10-24(23)29-17-30-27)5-4-12-28-26(33)16-35-3/h4-11,13-15,17H,12,16H2,1-3H3,(H,28,33)(H,29,30,31) |
| InChIKey | LEHXTTLCKJIFCM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|