C18H11Cl2FN2O3 — CID 69258247
5-chloro-1-[(2-chloro-4-fluorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione (PubChem CID 69258247) has the molecular formula C18H11Cl2FN2O3 and a molecular weight of 393.20 g/mol. Its IUPAC name is 5-chloro-1-[(2-chloro-4-fluorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione.
| Compound Name | 5-chloro-1-[(2-chloro-4-fluorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione |
|---|---|
| PubChem CID | 69258247 |
| Molecular Formula | C18H11Cl2FN2O3 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 5-chloro-1-[(2-chloro-4-fluorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2,2',5'-trione |
| SMILES | O=C1CC2(C(=O)N1)C(=O)N(Cc1ccc(F)cc1Cl)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C18H11Cl2FN2O3/c19-10-2-4-14-12(5-10)18(7-15(24)22-16(18)25)17(26)23(14)8-9-1-3-11(21)6-13(9)20/h1-6H,7-8H2,(H,22,24,25) |
| InChIKey | KSOYWAZBGJBPPR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|