C19H21N3O3 — CID 69258943
ethyl 2-[4-(4-cyano-3-methylphenoxy)-3-cyclopropyl-5-methylpyrazol-1-yl]acetate (PubChem CID 69258943) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl 2-[4-(4-cyano-3-methylphenoxy)-3-cyclopropyl-5-methylpyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-(4-cyano-3-methylphenoxy)-3-cyclopropyl-5-methylpyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 69258943 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 2-[4-(4-cyano-3-methylphenoxy)-3-cyclopropyl-5-methylpyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C2CC2)c(Oc2ccc(C#N)c(C)c2)c1C |
| InChI | InChI=1S/C19H21N3O3/c1-4-24-17(23)11-22-13(3)19(18(21-22)14-5-6-14)25-16-8-7-15(10-20)12(2)9-16/h7-9,14H,4-6,11H2,1-3H3 |
| InChIKey | HGDAWRXVBQVVMG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |