C16H14ClN3O5S — CID 159199467
methyl 4-(3-chloro-4-cyanophenoxy)-3-cyclopropyl-1-methylsulfonylpyrazole-5-carboxylate (PubChem CID 159199467) has the molecular formula C16H14ClN3O5S and a molecular weight of 395.82 g/mol. Its IUPAC name is methyl 4-(3-chloro-4-cyanophenoxy)-3-cyclopropyl-1-methylsulfonylpyrazole-5-carboxylate.
| Compound Name | methyl 4-(3-chloro-4-cyanophenoxy)-3-cyclopropyl-1-methylsulfonylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 159199467 |
| Molecular Formula | C16H14ClN3O5S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | methyl 4-(3-chloro-4-cyanophenoxy)-3-cyclopropyl-1-methylsulfonylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(Oc2ccc(C#N)c(Cl)c2)c(C2CC2)nn1S(C)(=O)=O |
| InChI | InChI=1S/C16H14ClN3O5S/c1-24-16(21)14-15(25-11-6-5-10(8-18)12(17)7-11)13(9-3-4-9)19-20(14)26(2,22)23/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | KPCFZIWWECVWOT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 111.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |