C12H22N4 — CID 69260242
N',N',N",N"-tetramethyl-N-(2-pyridin-3-ylethyl)methanetriamine (PubChem CID 69260242) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N',N',N",N"-tetramethyl-N-(2-pyridin-3-ylethyl)methanetriamine.
| Compound Name | N',N',N",N"-tetramethyl-N-(2-pyridin-3-ylethyl)methanetriamine |
|---|---|
| PubChem CID | 69260242 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N',N',N",N"-tetramethyl-N-(2-pyridin-3-ylethyl)methanetriamine |
| SMILES | CN(C)C(NCCc1cccnc1)N(C)C |
| InChI | InChI=1S/C12H22N4/c1-15(2)12(16(3)4)14-9-7-11-6-5-8-13-10-11/h5-6,8,10,12,14H,7,9H2,1-4H3 |
| InChIKey | KPPIDHMICUNNBD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|