C11H21FN2O2 — CID 69263028
[1-(1-fluorocyclohexyl)-1-(methylamino)propan-2-yl]carbamic acid (PubChem CID 69263028) has the molecular formula C11H21FN2O2 and a molecular weight of 232.30 g/mol. Its IUPAC name is [1-(1-fluorocyclohexyl)-1-(methylamino)propan-2-yl]carbamic acid.
| Compound Name | [1-(1-fluorocyclohexyl)-1-(methylamino)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69263028 |
| Molecular Formula | C11H21FN2O2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | [1-(1-fluorocyclohexyl)-1-(methylamino)propan-2-yl]carbamic acid |
| SMILES | CNC(C(C)NC(=O)O)C1(F)CCCCC1 |
| InChI | InChI=1S/C11H21FN2O2/c1-8(14-10(15)16)9(13-2)11(12)6-4-3-5-7-11/h8-9,13-14H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | NIYMELRPQCWDGJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |