C25H30N6O5S2 — CID 69263124
3-[[4-[2-[[(2-butanoylcyclopropyl)sulfonylamino]methyl]anilino]-5-methylpyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 69263124) has the molecular formula C25H30N6O5S2 and a molecular weight of 558.69 g/mol. Its IUPAC name is 3-[[4-[2-[[(2-butanoylcyclopropyl)sulfonylamino]methyl]anilino]-5-methylpyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-[2-[[(2-butanoylcyclopropyl)sulfonylamino]methyl]anilino]-5-methylpyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 69263124 |
| Molecular Formula | C25H30N6O5S2 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 3-[[4-[2-[[(2-butanoylcyclopropyl)sulfonylamino]methyl]anilino]-5-methylpyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | CCCC(=O)C1CC1S(=O)(=O)NCc1ccccc1Nc1nc(Nc2cccc(S(N)(=O)=O)c2)ncc1C |
| InChI | InChI=1S/C25H30N6O5S2/c1-3-7-22(32)20-13-23(20)38(35,36)28-15-17-8-4-5-11-21(17)30-24-16(2)14-27-25(31-24)29-18-9-6-10-19(12-18)37(26,33)34/h4-6,8-12,14,20,23,28H,3,7,13,15H2,1-2H3,(H2,26,33,34)(H2,27,29,30,31) |
| InChIKey | WJJNKTCULWVTDP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 173.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |