C12H24N2O2 — CID 69263152
[(2S)-5-(3-aminocyclohexyl)pentan-2-yl]carbamic acid (PubChem CID 69263152) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is [(2S)-5-(3-aminocyclohexyl)pentan-2-yl]carbamic acid.
| Compound Name | [(2S)-5-(3-aminocyclohexyl)pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69263152 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | [(2S)-5-(3-aminocyclohexyl)pentan-2-yl]carbamic acid |
| SMILES | C[C@@H](CCCC1CCCC(N)C1)NC(=O)O |
| InChI | InChI=1S/C12H24N2O2/c1-9(14-12(15)16)4-2-5-10-6-3-7-11(13)8-10/h9-11,14H,2-8,13H2,1H3,(H,15,16)/t9-,10?,11?/m0/s1 |
| InChIKey | GMXPGJDGSPLFJO-WHXUTIOJSA-N |
| XLogP | 2.33 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |